C23H20Cl2N4OS2 — CID 23998428
2-[(3-cyano-6-methyl-5,6,7,8-tetrahydroquinolin-2-yl)sulfanyl]-N-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]propanamide (PubChem CID 23998428) has the molecular formula C23H20Cl2N4OS2 and a molecular weight of 503.48 g/mol. Its IUPAC name is 2-[(3-cyano-6-methyl-5,6,7,8-tetrahydroquinolin-2-yl)sulfanyl]-N-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]propanamide.
| Compound Name | 2-[(3-cyano-6-methyl-5,6,7,8-tetrahydroquinolin-2-yl)sulfanyl]-N-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 23998428 |
| Molecular Formula | C23H20Cl2N4OS2 |
| Molecular Weight | 503.48 g/mol |
| Exact Mass | 502.05 |
| IUPAC Name | 2-[(3-cyano-6-methyl-5,6,7,8-tetrahydroquinolin-2-yl)sulfanyl]-N-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]propanamide |
| SMILES | CC1CCc2nc(SC(C)C(=O)Nc3nc(-c4ccc(Cl)cc4Cl)cs3)c(C#N)cc2C1 |
| InChI | InChI=1S/C23H20Cl2N4OS2/c1-12-3-6-19-14(7-12)8-15(10-26)22(27-19)32-13(2)21(30)29-23-28-20(11-31-23)17-5-4-16(24)9-18(17)25/h4-5,8-9,11-13H,3,6-7H2,1-2H3,(H,28,29,30) |
| InChIKey | HDKOHZVZYGFSHB-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.48 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |