About 3-amino-N,N,6-triphenylthieno[2,3-b]pyridine-2-carboxamide
3-amino-N,N,6-triphenylthieno[2,3-b]pyridine-2-carboxamide (PubChem CID 23999219) has the molecular formula C26H19N3OS
and a molecular weight of 421.53 g/mol. Its IUPAC name is 3-amino-N,N,6-triphenylthieno[2,3-b]pyridine-2-carboxamide.
Molecular Properties
| Compound Name | 3-amino-N,N,6-triphenylthieno[2,3-b]pyridine-2-carboxamide |
| PubChem CID | 23999219 |
| Molecular Formula | C26H19N3OS |
| Molecular Weight | 421.53 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | 3-amino-N,N,6-triphenylthieno[2,3-b]pyridine-2-carboxamide |
| SMILES | Nc1c(C(=O)N(c2ccccc2)c2ccccc2)sc2nc(-c3ccccc3)ccc12 |
| InChI | InChI=1S/C26H19N3OS/c27-23-21-16-17-22(18-10-4-1-5-11-18)28-25(21)31-24(23)26(30)29(19-12-6-2-7-13-19)20-14-8-3-9-15-20/h1-17H,27H2 |
| InChIKey | JCRJKMADWNNBER-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 421.53 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-amino-N,N,6-triphenylthieno[2,3-b]pyridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-N,N,6-triphenylthieno[2,3-b]pyridine-2-carboxamide?
The IUPAC name of 3-amino-N,N,6-triphenylthieno[2,3-b]pyridine-2-carboxamide (CID 23999219) is 3-amino-N,N,6-triphenylthieno[2,3-b]pyridine-2-carboxamide.
What is the SMILES notation for 3-amino-N,N,6-triphenylthieno[2,3-b]pyridine-2-carboxamide?
The canonical SMILES for 3-amino-N,N,6-triphenylthieno[2,3-b]pyridine-2-carboxamide is Nc1c(C(=O)N(c2ccccc2)c2ccccc2)sc2nc(-c3ccccc3)ccc12.
What is the InChIKey of 3-amino-N,N,6-triphenylthieno[2,3-b]pyridine-2-carboxamide?
The InChIKey is JCRJKMADWNNBER-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H19N3OS/c27-23-21-16-17-22(18-10-4-1-5-11-18)28-25(21)31-24(23)26(30)29(19-12-6-2-7-13-19)20-14-8-3-9-15-20/h1-17H,27H2.
What are the key properties of 3-amino-N,N,6-triphenylthieno[2,3-b]pyridine-2-carboxamide?
3-amino-N,N,6-triphenylthieno[2,3-b]pyridine-2-carboxamide has a molecular weight of 421.53 g/mol, XLogP of 6.52, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-N,N,6-triphenylthieno[2,3-b]pyridine-2-carboxamide is sourced from PubChem (CID 23999219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).