About (E)-N-[2-(3,4-dimethoxyphenyl)ethyl]-3-quinolin-2-ylprop-2-enamide
(E)-N-[2-(3,4-dimethoxyphenyl)ethyl]-3-quinolin-2-ylprop-2-enamide (PubChem CID 2400350) has the molecular formula C22H22N2O3
and a molecular weight of 362.43 g/mol. Its IUPAC name is (E)-N-[2-(3,4-dimethoxyphenyl)ethyl]-3-quinolin-2-ylprop-2-enamide.
Molecular Properties
| Compound Name | (E)-N-[2-(3,4-dimethoxyphenyl)ethyl]-3-quinolin-2-ylprop-2-enamide |
| PubChem CID | 2400350 |
| Molecular Formula | C22H22N2O3 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | (E)-N-[2-(3,4-dimethoxyphenyl)ethyl]-3-quinolin-2-ylprop-2-enamide |
| SMILES | COc1ccc(CCNC(=O)/C=C/c2ccc3ccccc3n2)cc1OC |
| InChI | InChI=1S/C22H22N2O3/c1-26-20-11-7-16(15-21(20)27-2)13-14-23-22(25)12-10-18-9-8-17-5-3-4-6-19(17)24-18/h3-12,15H,13-14H2,1-2H3,(H,23,25)/b12-10+ |
| InChIKey | VGPYNXVNFLQCJE-ZRDIBKRKSA-N |
| XLogP | 3.62 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-N-[2-(3,4-dimethoxyphenyl)ethyl]-3-quinolin-2-ylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N-[2-(3,4-dimethoxyphenyl)ethyl]-3-quinolin-2-ylprop-2-enamide?
The IUPAC name of (E)-N-[2-(3,4-dimethoxyphenyl)ethyl]-3-quinolin-2-ylprop-2-enamide (CID 2400350) is (E)-N-[2-(3,4-dimethoxyphenyl)ethyl]-3-quinolin-2-ylprop-2-enamide.
What is the SMILES notation for (E)-N-[2-(3,4-dimethoxyphenyl)ethyl]-3-quinolin-2-ylprop-2-enamide?
The canonical SMILES for (E)-N-[2-(3,4-dimethoxyphenyl)ethyl]-3-quinolin-2-ylprop-2-enamide is COc1ccc(CCNC(=O)/C=C/c2ccc3ccccc3n2)cc1OC.
What is the InChIKey of (E)-N-[2-(3,4-dimethoxyphenyl)ethyl]-3-quinolin-2-ylprop-2-enamide?
The InChIKey is VGPYNXVNFLQCJE-ZRDIBKRKSA-N. The full InChI is InChI=1S/C22H22N2O3/c1-26-20-11-7-16(15-21(20)27-2)13-14-23-22(25)12-10-18-9-8-17-5-3-4-6-19(17)24-18/h3-12,15H,13-14H2,1-2H3,(H,23,25)/b12-10+.
What are the key properties of (E)-N-[2-(3,4-dimethoxyphenyl)ethyl]-3-quinolin-2-ylprop-2-enamide?
(E)-N-[2-(3,4-dimethoxyphenyl)ethyl]-3-quinolin-2-ylprop-2-enamide has a molecular weight of 362.43 g/mol, XLogP of 3.62, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N-[2-(3,4-dimethoxyphenyl)ethyl]-3-quinolin-2-ylprop-2-enamide is sourced from PubChem (CID 2400350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).