C16H21FN4OS2 — CID 2400614
N,N-diethyl-4-[[5-(2-fluoroanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]butanamide (PubChem CID 2400614) has the molecular formula C16H21FN4OS2 and a molecular weight of 368.50 g/mol. Its IUPAC name is N,N-diethyl-4-[[5-(2-fluoroanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]butanamide.
| Compound Name | N,N-diethyl-4-[[5-(2-fluoroanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]butanamide |
|---|---|
| PubChem CID | 2400614 |
| Molecular Formula | C16H21FN4OS2 |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | N,N-diethyl-4-[[5-(2-fluoroanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]butanamide |
| SMILES | CCN(CC)C(=O)CCCSc1nnc(Nc2ccccc2F)s1 |
| InChI | InChI=1S/C16H21FN4OS2/c1-3-21(4-2)14(22)10-7-11-23-16-20-19-15(24-16)18-13-9-6-5-8-12(13)17/h5-6,8-9H,3-4,7,10-11H2,1-2H3,(H,18,19) |
| InChIKey | JYBSZMDXVVPNDE-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|