C14H14N2O6S — CID 2401241
(2-amino-2-oxoethyl) 4-(furan-2-ylmethylsulfamoyl)benzoate (PubChem CID 2401241) has the molecular formula C14H14N2O6S and a molecular weight of 338.34 g/mol. Its IUPAC name is (2-amino-2-oxoethyl) 4-(furan-2-ylmethylsulfamoyl)benzoate.
| Compound Name | (2-amino-2-oxoethyl) 4-(furan-2-ylmethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 2401241 |
| Molecular Formula | C14H14N2O6S |
| Molecular Weight | 338.34 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | (2-amino-2-oxoethyl) 4-(furan-2-ylmethylsulfamoyl)benzoate |
| SMILES | NC(=O)COC(=O)c1ccc(S(=O)(=O)NCc2ccco2)cc1 |
| InChI | InChI=1S/C14H14N2O6S/c15-13(17)9-22-14(18)10-3-5-12(6-4-10)23(19,20)16-8-11-2-1-7-21-11/h1-7,16H,8-9H2,(H2,15,17) |
| InChIKey | AJKHMUMYCXRDCE-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 128.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.34 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |