C20H18FN3O2S — CID 2401279
3-(2,3-dihydro-1,4-benzodioxin-6-ylmethylideneamino)-N-ethyl-4-(4-fluorophenyl)-1,3-thiazol-2-imine (PubChem CID 2401279) has the molecular formula C20H18FN3O2S and a molecular weight of 383.45 g/mol. Its IUPAC name is 3-(2,3-dihydro-1,4-benzodioxin-6-ylmethylideneamino)-N-ethyl-4-(4-fluorophenyl)-1,3-thiazol-2-imine.
| Compound Name | 3-(2,3-dihydro-1,4-benzodioxin-6-ylmethylideneamino)-N-ethyl-4-(4-fluorophenyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 2401279 |
| Molecular Formula | C20H18FN3O2S |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | 3-(2,3-dihydro-1,4-benzodioxin-6-ylmethylideneamino)-N-ethyl-4-(4-fluorophenyl)-1,3-thiazol-2-imine |
| SMILES | CC/N=c1\scc(-c2ccc(F)cc2)n1N=Cc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C20H18FN3O2S/c1-2-22-20-24(17(13-27-20)15-4-6-16(21)7-5-15)23-12-14-3-8-18-19(11-14)26-10-9-25-18/h3-8,11-13H,2,9-10H2,1H3/b22-20-,23-12? |
| InChIKey | LJSSVYYISROYIZ-LOHGNFSGSA-N |
| XLogP | 3.93 |
| TPSA | 48.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|