About N-[(2S)-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]propyl]benzenesulfonamide
N-[(2S)-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]propyl]benzenesulfonamide (PubChem CID 2402124) has the molecular formula C12H16N4O2S2
and a molecular weight of 312.42 g/mol. Its IUPAC name is N-[(2S)-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]propyl]benzenesulfonamide.
Molecular Properties
| Compound Name | N-[(2S)-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]propyl]benzenesulfonamide |
| PubChem CID | 2402124 |
| Molecular Formula | C12H16N4O2S2 |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | N-[(2S)-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]propyl]benzenesulfonamide |
| SMILES | C[C@@H](CNS(=O)(=O)c1ccccc1)Sc1nncn1C |
| InChI | InChI=1S/C12H16N4O2S2/c1-10(19-12-15-13-9-16(12)2)8-14-20(17,18)11-6-4-3-5-7-11/h3-7,9-10,14H,8H2,1-2H3/t10-/m0/s1 |
| InChIKey | DCUXSWQKYKQIFY-JTQLQIEISA-N |
| XLogP | 1.27 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[(2S)-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]propyl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2S)-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]propyl]benzenesulfonamide?
The IUPAC name of N-[(2S)-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]propyl]benzenesulfonamide (CID 2402124) is N-[(2S)-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]propyl]benzenesulfonamide.
What is the SMILES notation for N-[(2S)-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]propyl]benzenesulfonamide?
The canonical SMILES for N-[(2S)-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]propyl]benzenesulfonamide is C[C@@H](CNS(=O)(=O)c1ccccc1)Sc1nncn1C.
What is the InChIKey of N-[(2S)-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]propyl]benzenesulfonamide?
The InChIKey is DCUXSWQKYKQIFY-JTQLQIEISA-N. The full InChI is InChI=1S/C12H16N4O2S2/c1-10(19-12-15-13-9-16(12)2)8-14-20(17,18)11-6-4-3-5-7-11/h3-7,9-10,14H,8H2,1-2H3/t10-/m0/s1.
What are the key properties of N-[(2S)-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]propyl]benzenesulfonamide?
N-[(2S)-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]propyl]benzenesulfonamide has a molecular weight of 312.42 g/mol, XLogP of 1.27, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2S)-2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]propyl]benzenesulfonamide is sourced from PubChem (CID 2402124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).