C19H14F5NO — CID 2402485
(2Z)-1-(2,3,4,5,6-pentafluorophenyl)-2-(1,3,3-trimethylindol-2-ylidene)ethanone (PubChem CID 2402485) has the molecular formula C19H14F5NO and a molecular weight of 367.32 g/mol. Its IUPAC name is (2Z)-1-(2,3,4,5,6-pentafluorophenyl)-2-(1,3,3-trimethylindol-2-ylidene)ethanone.
| Compound Name | (2Z)-1-(2,3,4,5,6-pentafluorophenyl)-2-(1,3,3-trimethylindol-2-ylidene)ethanone |
|---|---|
| PubChem CID | 2402485 |
| Molecular Formula | C19H14F5NO |
| Molecular Weight | 367.32 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | (2Z)-1-(2,3,4,5,6-pentafluorophenyl)-2-(1,3,3-trimethylindol-2-ylidene)ethanone |
| SMILES | CN1/C(=C\C(=O)c2c(F)c(F)c(F)c(F)c2F)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C19H14F5NO/c1-19(2)9-6-4-5-7-10(9)25(3)12(19)8-11(26)13-14(20)16(22)18(24)17(23)15(13)21/h4-8H,1-3H3/b12-8- |
| InChIKey | JLCYZTWKWPKYTJ-WQLSENKSSA-N |
| XLogP | 4.88 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.32 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|