C27H26N2O2S — CID 2402566
3-benzyl-2-[(2S)-1-oxo-1-(4-propylphenyl)propan-2-yl]sulfanylquinazolin-4-one (PubChem CID 2402566) has the molecular formula C27H26N2O2S and a molecular weight of 442.58 g/mol. Its IUPAC name is 3-benzyl-2-[(2S)-1-oxo-1-(4-propylphenyl)propan-2-yl]sulfanylquinazolin-4-one.
| Compound Name | 3-benzyl-2-[(2S)-1-oxo-1-(4-propylphenyl)propan-2-yl]sulfanylquinazolin-4-one |
|---|---|
| PubChem CID | 2402566 |
| Molecular Formula | C27H26N2O2S |
| Molecular Weight | 442.58 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | 3-benzyl-2-[(2S)-1-oxo-1-(4-propylphenyl)propan-2-yl]sulfanylquinazolin-4-one |
| SMILES | CCCc1ccc(C(=O)[C@H](C)Sc2nc3ccccc3c(=O)n2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C27H26N2O2S/c1-3-9-20-14-16-22(17-15-20)25(30)19(2)32-27-28-24-13-8-7-12-23(24)26(31)29(27)18-21-10-5-4-6-11-21/h4-8,10-17,19H,3,9,18H2,1-2H3/t19-/m0/s1 |
| InChIKey | QZZSRXLHZYENMZ-IBGZPJMESA-N |
| XLogP | 5.76 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.58 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |