C9H8N2S3 — CID 2402616
3-(2-methylphenyl)-1,3,4-thiadiazolidine-2,5-dithione (PubChem CID 2402616) has the molecular formula C9H8N2S3 and a molecular weight of 240.38 g/mol. Its IUPAC name is 3-(2-methylphenyl)-1,3,4-thiadiazolidine-2,5-dithione.
| Compound Name | 3-(2-methylphenyl)-1,3,4-thiadiazolidine-2,5-dithione |
|---|---|
| PubChem CID | 2402616 |
| Molecular Formula | C9H8N2S3 |
| Molecular Weight | 240.38 g/mol |
| Exact Mass | 239.98 |
| IUPAC Name | 3-(2-methylphenyl)-1,3,4-thiadiazolidine-2,5-dithione |
| SMILES | Cc1ccccc1-n1[nH]c(=S)sc1=S |
| InChI | InChI=1S/C9H8N2S3/c1-6-4-2-3-5-7(6)11-9(13)14-8(12)10-11/h2-5H,1H3,(H,10,12) |
| InChIKey | PRDJFGGJAKYVGA-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.38 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|