C9H10F3N3O3 — CID 2402663
6-amino-1-propyl-5-(2,2,2-trifluoroacetyl)pyrimidine-2,4-dione (PubChem CID 2402663) has the molecular formula C9H10F3N3O3 and a molecular weight of 265.19 g/mol. Its IUPAC name is 6-amino-1-propyl-5-(2,2,2-trifluoroacetyl)pyrimidine-2,4-dione.
| Compound Name | 6-amino-1-propyl-5-(2,2,2-trifluoroacetyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 2402663 |
| Molecular Formula | C9H10F3N3O3 |
| Molecular Weight | 265.19 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | 6-amino-1-propyl-5-(2,2,2-trifluoroacetyl)pyrimidine-2,4-dione |
| SMILES | CCCn1c(N)c(C(=O)C(F)(F)F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C9H10F3N3O3/c1-2-3-15-6(13)4(5(16)9(10,11)12)7(17)14-8(15)18/h2-3,13H2,1H3,(H,14,17,18) |
| InChIKey | NIKHSFPBPSGAOW-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 97.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.19 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |