About [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] 2-[(3,4-dimethoxybenzoyl)amino]acetate
[2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] 2-[(3,4-dimethoxybenzoyl)amino]acetate (PubChem CID 2403834) has the molecular formula C18H17N3O6S
and a molecular weight of 403.42 g/mol. Its IUPAC name is [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] 2-[(3,4-dimethoxybenzoyl)amino]acetate.
Molecular Properties
| Compound Name | [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] 2-[(3,4-dimethoxybenzoyl)amino]acetate |
| PubChem CID | 2403834 |
| Molecular Formula | C18H17N3O6S |
| Molecular Weight | 403.42 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] 2-[(3,4-dimethoxybenzoyl)amino]acetate |
| SMILES | COc1ccc(C(=O)NCC(=O)OCC(=O)Nc2sccc2C#N)cc1OC |
| InChI | InChI=1S/C18H17N3O6S/c1-25-13-4-3-11(7-14(13)26-2)17(24)20-9-16(23)27-10-15(22)21-18-12(8-19)5-6-28-18/h3-7H,9-10H2,1-2H3,(H,20,24)(H,21,22) |
| InChIKey | PKBLVBSTMSMIQA-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 126.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.42 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] 2-[(3,4-dimethoxybenzoyl)amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] 2-[(3,4-dimethoxybenzoyl)amino]acetate?
The IUPAC name of [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] 2-[(3,4-dimethoxybenzoyl)amino]acetate (CID 2403834) is [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] 2-[(3,4-dimethoxybenzoyl)amino]acetate.
What is the SMILES notation for [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] 2-[(3,4-dimethoxybenzoyl)amino]acetate?
The canonical SMILES for [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] 2-[(3,4-dimethoxybenzoyl)amino]acetate is COc1ccc(C(=O)NCC(=O)OCC(=O)Nc2sccc2C#N)cc1OC.
What is the InChIKey of [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] 2-[(3,4-dimethoxybenzoyl)amino]acetate?
The InChIKey is PKBLVBSTMSMIQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17N3O6S/c1-25-13-4-3-11(7-14(13)26-2)17(24)20-9-16(23)27-10-15(22)21-18-12(8-19)5-6-28-18/h3-7H,9-10H2,1-2H3,(H,20,24)(H,21,22).
What are the key properties of [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] 2-[(3,4-dimethoxybenzoyl)amino]acetate?
[2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] 2-[(3,4-dimethoxybenzoyl)amino]acetate has a molecular weight of 403.42 g/mol, XLogP of 1.55, 8 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] 2-[(3,4-dimethoxybenzoyl)amino]acetate is sourced from PubChem (CID 2403834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).