C22H28N2OS — CID 2403866
N-[2-(cyclohexen-1-yl)ethyl]-2-(4,6,8-trimethylquinolin-2-yl)sulfanylacetamide (PubChem CID 2403866) has the molecular formula C22H28N2OS and a molecular weight of 368.55 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-2-(4,6,8-trimethylquinolin-2-yl)sulfanylacetamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-2-(4,6,8-trimethylquinolin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 2403866 |
| Molecular Formula | C22H28N2OS |
| Molecular Weight | 368.55 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-2-(4,6,8-trimethylquinolin-2-yl)sulfanylacetamide |
| SMILES | Cc1cc(C)c2nc(SCC(=O)NCCC3=CCCCC3)cc(C)c2c1 |
| InChI | InChI=1S/C22H28N2OS/c1-15-11-17(3)22-19(12-15)16(2)13-21(24-22)26-14-20(25)23-10-9-18-7-5-4-6-8-18/h7,11-13H,4-6,8-10,14H2,1-3H3,(H,23,25) |
| InChIKey | PXNCOQGETTXBEH-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.55 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|