C18H17N3O3S2 — CID 2404492
methyl 4-[2,5-dimethyl-3-[2-(1,3,4-thiadiazol-2-ylsulfanyl)acetyl]pyrrol-1-yl]benzoate (PubChem CID 2404492) has the molecular formula C18H17N3O3S2 and a molecular weight of 387.49 g/mol. Its IUPAC name is methyl 4-[2,5-dimethyl-3-[2-(1,3,4-thiadiazol-2-ylsulfanyl)acetyl]pyrrol-1-yl]benzoate.
| Compound Name | methyl 4-[2,5-dimethyl-3-[2-(1,3,4-thiadiazol-2-ylsulfanyl)acetyl]pyrrol-1-yl]benzoate |
|---|---|
| PubChem CID | 2404492 |
| Molecular Formula | C18H17N3O3S2 |
| Molecular Weight | 387.49 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | methyl 4-[2,5-dimethyl-3-[2-(1,3,4-thiadiazol-2-ylsulfanyl)acetyl]pyrrol-1-yl]benzoate |
| SMILES | COC(=O)c1ccc(-n2c(C)cc(C(=O)CSc3nncs3)c2C)cc1 |
| InChI | InChI=1S/C18H17N3O3S2/c1-11-8-15(16(22)9-25-18-20-19-10-26-18)12(2)21(11)14-6-4-13(5-7-14)17(23)24-3/h4-8,10H,9H2,1-3H3 |
| InChIKey | SWMVHVGXLULDBL-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.49 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|