C21H16N4O2 — CID 2404738
2-[4-(4-cyanophenyl)phenoxy]-N-(pyridin-4-ylmethylideneamino)acetamide (PubChem CID 2404738) has the molecular formula C21H16N4O2 and a molecular weight of 356.39 g/mol. Its IUPAC name is 2-[4-(4-cyanophenyl)phenoxy]-N-(pyridin-4-ylmethylideneamino)acetamide.
| Compound Name | 2-[4-(4-cyanophenyl)phenoxy]-N-(pyridin-4-ylmethylideneamino)acetamide |
|---|---|
| PubChem CID | 2404738 |
| Molecular Formula | C21H16N4O2 |
| Molecular Weight | 356.39 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 2-[4-(4-cyanophenyl)phenoxy]-N-(pyridin-4-ylmethylideneamino)acetamide |
| SMILES | N#Cc1ccc(-c2ccc(OCC(=O)NN=Cc3ccncc3)cc2)cc1 |
| InChI | InChI=1S/C21H16N4O2/c22-13-16-1-3-18(4-2-16)19-5-7-20(8-6-19)27-15-21(26)25-24-14-17-9-11-23-12-10-17/h1-12,14H,15H2,(H,25,26) |
| InChIKey | RKRCZQHKWRDOJI-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 87.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.39 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|