C31H26Cl2N4O2 — CID 2405572
(2S)-10,12-dichloro-2-(3-methoxy-4-phenylmethoxyphenyl)-4-methyl-6-(4-methylphenyl)-1,5,6,8-tetrazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene (PubChem CID 2405572) has the molecular formula C31H26Cl2N4O2 and a molecular weight of 557.48 g/mol. Its IUPAC name is (2S)-10,12-dichloro-2-(3-methoxy-4-phenylmethoxyphenyl)-4-methyl-6-(4-methylphenyl)-1,5,6,8-tetrazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene.
| Compound Name | (2S)-10,12-dichloro-2-(3-methoxy-4-phenylmethoxyphenyl)-4-methyl-6-(4-methylphenyl)-1,5,6,8-tetrazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene |
|---|---|
| PubChem CID | 2405572 |
| Molecular Formula | C31H26Cl2N4O2 |
| Molecular Weight | 557.48 g/mol |
| Exact Mass | 556.14 |
| IUPAC Name | (2S)-10,12-dichloro-2-(3-methoxy-4-phenylmethoxyphenyl)-4-methyl-6-(4-methylphenyl)-1,5,6,8-tetrazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene |
| SMILES | COc1cc([C@H]2c3c(C)nn(-c4ccc(C)cc4)c3N=C3C(Cl)=CC(Cl)=CN32)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C31H26Cl2N4O2/c1-19-9-12-24(13-10-19)37-31-28(20(2)35-37)29(36-17-23(32)16-25(33)30(36)34-31)22-11-14-26(27(15-22)38-3)39-18-21-7-5-4-6-8-21/h4-17,29H,18H2,1-3H3/t29-/m0/s1 |
| InChIKey | IFFHXXVNFZITMK-LJAQVGFWSA-N |
| XLogP | 7.73 |
| TPSA | 51.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.48 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |