C26H18Cl2N4 — CID 2405697
(17R)-13,17-bis(4-chlorophenyl)-15-methyl-1,11,13,14-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6,8,10,12(16),14-heptaene (PubChem CID 2405697) has the molecular formula C26H18Cl2N4 and a molecular weight of 457.36 g/mol. Its IUPAC name is (17R)-13,17-bis(4-chlorophenyl)-15-methyl-1,11,13,14-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6,8,10,12(16),14-heptaene.
| Compound Name | (17R)-13,17-bis(4-chlorophenyl)-15-methyl-1,11,13,14-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6,8,10,12(16),14-heptaene |
|---|---|
| PubChem CID | 2405697 |
| Molecular Formula | C26H18Cl2N4 |
| Molecular Weight | 457.36 g/mol |
| Exact Mass | 456.09 |
| IUPAC Name | (17R)-13,17-bis(4-chlorophenyl)-15-methyl-1,11,13,14-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6,8,10,12(16),14-heptaene |
| SMILES | Cc1nn(-c2ccc(Cl)cc2)c2c1[C@@H](c1ccc(Cl)cc1)N1C(=N2)C=Cc2ccccc21 |
| InChI | InChI=1S/C26H18Cl2N4/c1-16-24-25(18-6-9-19(27)10-7-18)31-22-5-3-2-4-17(22)8-15-23(31)29-26(24)32(30-16)21-13-11-20(28)12-14-21/h2-15,25H,1H3/t25-/m1/s1 |
| InChIKey | XCKGDMGJBLRMSO-RUZDIDTESA-N |
| XLogP | 7.15 |
| TPSA | 33.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.36 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |