About 4-(dimethylamino)-2,2-diphenylbutanenitrile
4-(dimethylamino)-2,2-diphenylbutanenitrile (PubChem CID 24060) has the molecular formula C18H20N2
and a molecular weight of 264.37 g/mol. Its IUPAC name is 4-(dimethylamino)-2,2-diphenylbutanenitrile.
Molecular Properties
| Compound Name | 4-(dimethylamino)-2,2-diphenylbutanenitrile |
| PubChem CID | 24060 |
| Molecular Formula | C18H20N2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | 4-(dimethylamino)-2,2-diphenylbutanenitrile |
| SMILES | CN(C)CCC(C#N)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H20N2/c1-20(2)14-13-18(15-19,16-9-5-3-6-10-16)17-11-7-4-8-12-17/h3-12H,13-14H2,1-2H3 |
| InChIKey | SZOCKYDZSPRJPT-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(dimethylamino)-2,2-diphenylbutanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(dimethylamino)-2,2-diphenylbutanenitrile?
The IUPAC name of 4-(dimethylamino)-2,2-diphenylbutanenitrile (CID 24060) is 4-(dimethylamino)-2,2-diphenylbutanenitrile.
What is the SMILES notation for 4-(dimethylamino)-2,2-diphenylbutanenitrile?
The canonical SMILES for 4-(dimethylamino)-2,2-diphenylbutanenitrile is CN(C)CCC(C#N)(c1ccccc1)c1ccccc1.
What is the InChIKey of 4-(dimethylamino)-2,2-diphenylbutanenitrile?
The InChIKey is SZOCKYDZSPRJPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N2/c1-20(2)14-13-18(15-19,16-9-5-3-6-10-16)17-11-7-4-8-12-17/h3-12H,13-14H2,1-2H3.
What are the key properties of 4-(dimethylamino)-2,2-diphenylbutanenitrile?
4-(dimethylamino)-2,2-diphenylbutanenitrile has a molecular weight of 264.37 g/mol, XLogP of 3.45, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(dimethylamino)-2,2-diphenylbutanenitrile is sourced from PubChem (CID 24060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).