About 3-methoxy-5,6-diphenyl-1,2,4-triazine
3-methoxy-5,6-diphenyl-1,2,4-triazine (PubChem CID 24063) has the molecular formula C16H13N3O
and a molecular weight of 263.30 g/mol. Its IUPAC name is 3-methoxy-5,6-diphenyl-1,2,4-triazine.
Molecular Properties
| Compound Name | 3-methoxy-5,6-diphenyl-1,2,4-triazine |
| PubChem CID | 24063 |
| Molecular Formula | C16H13N3O |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | 3-methoxy-5,6-diphenyl-1,2,4-triazine |
| SMILES | COc1nnc(-c2ccccc2)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C16H13N3O/c1-20-16-17-14(12-8-4-2-5-9-12)15(18-19-16)13-10-6-3-7-11-13/h2-11H,1H3 |
| InChIKey | WIYOPYDPWIXASZ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-methoxy-5,6-diphenyl-1,2,4-triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-5,6-diphenyl-1,2,4-triazine?
The IUPAC name of 3-methoxy-5,6-diphenyl-1,2,4-triazine (CID 24063) is 3-methoxy-5,6-diphenyl-1,2,4-triazine.
What is the SMILES notation for 3-methoxy-5,6-diphenyl-1,2,4-triazine?
The canonical SMILES for 3-methoxy-5,6-diphenyl-1,2,4-triazine is COc1nnc(-c2ccccc2)c(-c2ccccc2)n1.
What is the InChIKey of 3-methoxy-5,6-diphenyl-1,2,4-triazine?
The InChIKey is WIYOPYDPWIXASZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13N3O/c1-20-16-17-14(12-8-4-2-5-9-12)15(18-19-16)13-10-6-3-7-11-13/h2-11H,1H3.
What are the key properties of 3-methoxy-5,6-diphenyl-1,2,4-triazine?
3-methoxy-5,6-diphenyl-1,2,4-triazine has a molecular weight of 263.30 g/mol, XLogP of 3.21, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-5,6-diphenyl-1,2,4-triazine is sourced from PubChem (CID 24063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).