About [2-(cyclopropylamino)-2-oxoethyl] 2-(3,5-dimethylphenoxy)acetate
[2-(cyclopropylamino)-2-oxoethyl] 2-(3,5-dimethylphenoxy)acetate (PubChem CID 2406815) has the molecular formula C15H19NO4
and a molecular weight of 277.32 g/mol. Its IUPAC name is [2-(cyclopropylamino)-2-oxoethyl] 2-(3,5-dimethylphenoxy)acetate.
Molecular Properties
| Compound Name | [2-(cyclopropylamino)-2-oxoethyl] 2-(3,5-dimethylphenoxy)acetate |
| PubChem CID | 2406815 |
| Molecular Formula | C15H19NO4 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | [2-(cyclopropylamino)-2-oxoethyl] 2-(3,5-dimethylphenoxy)acetate |
| SMILES | Cc1cc(C)cc(OCC(=O)OCC(=O)NC2CC2)c1 |
| InChI | InChI=1S/C15H19NO4/c1-10-5-11(2)7-13(6-10)19-9-15(18)20-8-14(17)16-12-3-4-12/h5-7,12H,3-4,8-9H2,1-2H3,(H,16,17) |
| InChIKey | KYVPRAPYPOTPOC-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(cyclopropylamino)-2-oxoethyl] 2-(3,5-dimethylphenoxy)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(cyclopropylamino)-2-oxoethyl] 2-(3,5-dimethylphenoxy)acetate?
The IUPAC name of [2-(cyclopropylamino)-2-oxoethyl] 2-(3,5-dimethylphenoxy)acetate (CID 2406815) is [2-(cyclopropylamino)-2-oxoethyl] 2-(3,5-dimethylphenoxy)acetate.
What is the SMILES notation for [2-(cyclopropylamino)-2-oxoethyl] 2-(3,5-dimethylphenoxy)acetate?
The canonical SMILES for [2-(cyclopropylamino)-2-oxoethyl] 2-(3,5-dimethylphenoxy)acetate is Cc1cc(C)cc(OCC(=O)OCC(=O)NC2CC2)c1.
What is the InChIKey of [2-(cyclopropylamino)-2-oxoethyl] 2-(3,5-dimethylphenoxy)acetate?
The InChIKey is KYVPRAPYPOTPOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19NO4/c1-10-5-11(2)7-13(6-10)19-9-15(18)20-8-14(17)16-12-3-4-12/h5-7,12H,3-4,8-9H2,1-2H3,(H,16,17).
What are the key properties of [2-(cyclopropylamino)-2-oxoethyl] 2-(3,5-dimethylphenoxy)acetate?
[2-(cyclopropylamino)-2-oxoethyl] 2-(3,5-dimethylphenoxy)acetate has a molecular weight of 277.32 g/mol, XLogP of 1.50, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(cyclopropylamino)-2-oxoethyl] 2-(3,5-dimethylphenoxy)acetate is sourced from PubChem (CID 2406815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).