About 2,4-dichloro-6-(3,5-dichloro-2-oxidophenyl)sulfanylphenolate
2,4-dichloro-6-(3,5-dichloro-2-oxidophenyl)sulfanylphenolate (PubChem CID 2407) has the molecular formula C12H4Cl4O2S-2
and a molecular weight of 354.04 g/mol. Its IUPAC name is 2,4-dichloro-6-(3,5-dichloro-2-oxidophenyl)sulfanylphenolate.
Molecular Properties
| Compound Name | 2,4-dichloro-6-(3,5-dichloro-2-oxidophenyl)sulfanylphenolate |
| PubChem CID | 2407 |
| Molecular Formula | C12H4Cl4O2S-2 |
| Molecular Weight | 354.04 g/mol |
| Exact Mass | 351.87 |
| IUPAC Name | 2,4-dichloro-6-(3,5-dichloro-2-oxidophenyl)sulfanylphenolate |
| SMILES | [O-]c1c(Cl)cc(Cl)cc1Sc1cc(Cl)cc(Cl)c1[O-] |
| InChI | InChI=1S/C12H6Cl4O2S/c13-5-1-7(15)11(17)9(3-5)19-10-4-6(14)2-8(16)12(10)18/h1-4,17-18H/p-2 |
| InChIKey | JFIOVJDNOJYLKP-UHFFFAOYSA-L |
| XLogP | 4.60 |
| TPSA | 46.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.04 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,4-dichloro-6-(3,5-dichloro-2-oxidophenyl)sulfanylphenolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dichloro-6-(3,5-dichloro-2-oxidophenyl)sulfanylphenolate?
The IUPAC name of 2,4-dichloro-6-(3,5-dichloro-2-oxidophenyl)sulfanylphenolate (CID 2407) is 2,4-dichloro-6-(3,5-dichloro-2-oxidophenyl)sulfanylphenolate.
What is the SMILES notation for 2,4-dichloro-6-(3,5-dichloro-2-oxidophenyl)sulfanylphenolate?
The canonical SMILES for 2,4-dichloro-6-(3,5-dichloro-2-oxidophenyl)sulfanylphenolate is [O-]c1c(Cl)cc(Cl)cc1Sc1cc(Cl)cc(Cl)c1[O-].
What is the InChIKey of 2,4-dichloro-6-(3,5-dichloro-2-oxidophenyl)sulfanylphenolate?
The InChIKey is JFIOVJDNOJYLKP-UHFFFAOYSA-L. The full InChI is InChI=1S/C12H6Cl4O2S/c13-5-1-7(15)11(17)9(3-5)19-10-4-6(14)2-8(16)12(10)18/h1-4,17-18H/p-2.
What are the key properties of 2,4-dichloro-6-(3,5-dichloro-2-oxidophenyl)sulfanylphenolate?
2,4-dichloro-6-(3,5-dichloro-2-oxidophenyl)sulfanylphenolate has a molecular weight of 354.04 g/mol, XLogP of 4.60, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dichloro-6-(3,5-dichloro-2-oxidophenyl)sulfanylphenolate is sourced from PubChem (CID 2407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).