C16H20N4OS — CID 2407114
N-cyclohexyl-2-[(4-phenyl-1,2,4-triazol-3-yl)sulfanyl]acetamide (PubChem CID 2407114) has the molecular formula C16H20N4OS and a molecular weight of 316.43 g/mol. Its IUPAC name is N-cyclohexyl-2-[(4-phenyl-1,2,4-triazol-3-yl)sulfanyl]acetamide.
| Compound Name | N-cyclohexyl-2-[(4-phenyl-1,2,4-triazol-3-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 2407114 |
| Molecular Formula | C16H20N4OS |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | N-cyclohexyl-2-[(4-phenyl-1,2,4-triazol-3-yl)sulfanyl]acetamide |
| SMILES | O=C(CSc1nncn1-c1ccccc1)NC1CCCCC1 |
| InChI | InChI=1S/C16H20N4OS/c21-15(18-13-7-3-1-4-8-13)11-22-16-19-17-12-20(16)14-9-5-2-6-10-14/h2,5-6,9-10,12-13H,1,3-4,7-8,11H2,(H,18,21) |
| InChIKey | DTEKDBGQVPJBHH-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |