C17H15Br2NO4 — CID 2407342
2-(3-bromophenoxy)ethyl 2-[(4-bromobenzoyl)amino]acetate (PubChem CID 2407342) has the molecular formula C17H15Br2NO4 and a molecular weight of 457.12 g/mol. Its IUPAC name is 2-(3-bromophenoxy)ethyl 2-[(4-bromobenzoyl)amino]acetate.
| Compound Name | 2-(3-bromophenoxy)ethyl 2-[(4-bromobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 2407342 |
| Molecular Formula | C17H15Br2NO4 |
| Molecular Weight | 457.12 g/mol |
| Exact Mass | 454.94 |
| IUPAC Name | 2-(3-bromophenoxy)ethyl 2-[(4-bromobenzoyl)amino]acetate |
| SMILES | O=C(CNC(=O)c1ccc(Br)cc1)OCCOc1cccc(Br)c1 |
| InChI | InChI=1S/C17H15Br2NO4/c18-13-6-4-12(5-7-13)17(22)20-11-16(21)24-9-8-23-15-3-1-2-14(19)10-15/h1-7,10H,8-9,11H2,(H,20,22) |
| InChIKey | MJKZUAXGYNPYDM-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.12 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|