C17H11NO4S2 — CID 2408325
3-[(5E)-5-[(2-hydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzoic acid (PubChem CID 2408325) has the molecular formula C17H11NO4S2 and a molecular weight of 357.41 g/mol. Its IUPAC name is 3-[(5E)-5-[(2-hydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzoic acid.
| Compound Name | 3-[(5E)-5-[(2-hydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzoic acid |
|---|---|
| PubChem CID | 2408325 |
| Molecular Formula | C17H11NO4S2 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.01 |
| IUPAC Name | 3-[(5E)-5-[(2-hydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzoic acid |
| SMILES | O=C(O)c1cccc(N2C(=O)/C(=C\c3ccccc3O)SC2=S)c1 |
| InChI | InChI=1S/C17H11NO4S2/c19-13-7-2-1-4-10(13)9-14-15(20)18(17(23)24-14)12-6-3-5-11(8-12)16(21)22/h1-9,19H,(H,21,22)/b14-9+ |
| InChIKey | GRZLHGXVUKGZAV-NTEUORMPSA-N |
| XLogP | 3.50 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|