About methyl (2R)-2-(1,3-benzodioxole-5-carbonylamino)-3-(1H-indol-3-yl)propanoate
methyl (2R)-2-(1,3-benzodioxole-5-carbonylamino)-3-(1H-indol-3-yl)propanoate (PubChem CID 2408827) has the molecular formula C20H18N2O5
and a molecular weight of 366.37 g/mol. Its IUPAC name is methyl (2R)-2-(1,3-benzodioxole-5-carbonylamino)-3-(1H-indol-3-yl)propanoate.
Molecular Properties
| Compound Name | methyl (2R)-2-(1,3-benzodioxole-5-carbonylamino)-3-(1H-indol-3-yl)propanoate |
| PubChem CID | 2408827 |
| Molecular Formula | C20H18N2O5 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | methyl (2R)-2-(1,3-benzodioxole-5-carbonylamino)-3-(1H-indol-3-yl)propanoate |
| SMILES | COC(=O)[C@@H](Cc1c[nH]c2ccccc12)NC(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H18N2O5/c1-25-20(24)16(8-13-10-21-15-5-3-2-4-14(13)15)22-19(23)12-6-7-17-18(9-12)27-11-26-17/h2-7,9-10,16,21H,8,11H2,1H3,(H,22,23)/t16-/m1/s1 |
| InChIKey | BNAZOOCFECXZBZ-MRXNPFEDSA-N |
| XLogP | 2.41 |
| TPSA | 89.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl (2R)-2-(1,3-benzodioxole-5-carbonylamino)-3-(1H-indol-3-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2R)-2-(1,3-benzodioxole-5-carbonylamino)-3-(1H-indol-3-yl)propanoate?
The IUPAC name of methyl (2R)-2-(1,3-benzodioxole-5-carbonylamino)-3-(1H-indol-3-yl)propanoate (CID 2408827) is methyl (2R)-2-(1,3-benzodioxole-5-carbonylamino)-3-(1H-indol-3-yl)propanoate.
What is the SMILES notation for methyl (2R)-2-(1,3-benzodioxole-5-carbonylamino)-3-(1H-indol-3-yl)propanoate?
The canonical SMILES for methyl (2R)-2-(1,3-benzodioxole-5-carbonylamino)-3-(1H-indol-3-yl)propanoate is COC(=O)[C@@H](Cc1c[nH]c2ccccc12)NC(=O)c1ccc2c(c1)OCO2.
What is the InChIKey of methyl (2R)-2-(1,3-benzodioxole-5-carbonylamino)-3-(1H-indol-3-yl)propanoate?
The InChIKey is BNAZOOCFECXZBZ-MRXNPFEDSA-N. The full InChI is InChI=1S/C20H18N2O5/c1-25-20(24)16(8-13-10-21-15-5-3-2-4-14(13)15)22-19(23)12-6-7-17-18(9-12)27-11-26-17/h2-7,9-10,16,21H,8,11H2,1H3,(H,22,23)/t16-/m1/s1.
What are the key properties of methyl (2R)-2-(1,3-benzodioxole-5-carbonylamino)-3-(1H-indol-3-yl)propanoate?
methyl (2R)-2-(1,3-benzodioxole-5-carbonylamino)-3-(1H-indol-3-yl)propanoate has a molecular weight of 366.37 g/mol, XLogP of 2.41, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2R)-2-(1,3-benzodioxole-5-carbonylamino)-3-(1H-indol-3-yl)propanoate is sourced from PubChem (CID 2408827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).