About 4-cyano-N-(1,2,4-triazol-4-yl)benzamide
4-cyano-N-(1,2,4-triazol-4-yl)benzamide (PubChem CID 2409153) has the molecular formula C10H7N5O
and a molecular weight of 213.20 g/mol. Its IUPAC name is 4-cyano-N-(1,2,4-triazol-4-yl)benzamide.
Molecular Properties
| Compound Name | 4-cyano-N-(1,2,4-triazol-4-yl)benzamide |
| PubChem CID | 2409153 |
| Molecular Formula | C10H7N5O |
| Molecular Weight | 213.20 g/mol |
| Exact Mass | 213.07 |
| IUPAC Name | 4-cyano-N-(1,2,4-triazol-4-yl)benzamide |
| SMILES | N#Cc1ccc(C(=O)Nn2cnnc2)cc1 |
| InChI | InChI=1S/C10H7N5O/c11-5-8-1-3-9(4-2-8)10(16)14-15-6-12-13-7-15/h1-4,6-7H,(H,14,16) |
| InChIKey | ILJQWGSHQPQAJW-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.20 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-cyano-N-(1,2,4-triazol-4-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyano-N-(1,2,4-triazol-4-yl)benzamide?
The IUPAC name of 4-cyano-N-(1,2,4-triazol-4-yl)benzamide (CID 2409153) is 4-cyano-N-(1,2,4-triazol-4-yl)benzamide.
What is the SMILES notation for 4-cyano-N-(1,2,4-triazol-4-yl)benzamide?
The canonical SMILES for 4-cyano-N-(1,2,4-triazol-4-yl)benzamide is N#Cc1ccc(C(=O)Nn2cnnc2)cc1.
What is the InChIKey of 4-cyano-N-(1,2,4-triazol-4-yl)benzamide?
The InChIKey is ILJQWGSHQPQAJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7N5O/c11-5-8-1-3-9(4-2-8)10(16)14-15-6-12-13-7-15/h1-4,6-7H,(H,14,16).
What are the key properties of 4-cyano-N-(1,2,4-triazol-4-yl)benzamide?
4-cyano-N-(1,2,4-triazol-4-yl)benzamide has a molecular weight of 213.20 g/mol, XLogP of 0.53, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyano-N-(1,2,4-triazol-4-yl)benzamide is sourced from PubChem (CID 2409153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).