About dipropan-2-yl decanedioate
dipropan-2-yl decanedioate (PubChem CID 24096) has the molecular formula C16H30O4
and a molecular weight of 286.41 g/mol. Its IUPAC name is dipropan-2-yl decanedioate.
Molecular Properties
| Compound Name | dipropan-2-yl decanedioate |
| PubChem CID | 24096 |
| Molecular Formula | C16H30O4 |
| Molecular Weight | 286.41 g/mol |
| Exact Mass | 286.21 |
| IUPAC Name | dipropan-2-yl decanedioate |
| SMILES | CC(C)OC(=O)CCCCCCCCC(=O)OC(C)C |
| InChI | InChI=1S/C16H30O4/c1-13(2)19-15(17)11-9-7-5-6-8-10-12-16(18)20-14(3)4/h13-14H,5-12H2,1-4H3 |
| InChIKey | XFKBBSZEQRFVSL-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.41 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze dipropan-2-yl decanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipropan-2-yl decanedioate?
The IUPAC name of dipropan-2-yl decanedioate (CID 24096) is dipropan-2-yl decanedioate.
What is the SMILES notation for dipropan-2-yl decanedioate?
The canonical SMILES for dipropan-2-yl decanedioate is CC(C)OC(=O)CCCCCCCCC(=O)OC(C)C.
What is the InChIKey of dipropan-2-yl decanedioate?
The InChIKey is XFKBBSZEQRFVSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30O4/c1-13(2)19-15(17)11-9-7-5-6-8-10-12-16(18)20-14(3)4/h13-14H,5-12H2,1-4H3.
What are the key properties of dipropan-2-yl decanedioate?
dipropan-2-yl decanedioate has a molecular weight of 286.41 g/mol, XLogP of 4.01, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dipropan-2-yl decanedioate is sourced from PubChem (CID 24096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).