C17H12ClNO5 — CID 2409679
[2-oxo-2-(3-oxo-4H-1,4-benzoxazin-6-yl)ethyl] 2-chlorobenzoate (PubChem CID 2409679) has the molecular formula C17H12ClNO5 and a molecular weight of 345.74 g/mol. Its IUPAC name is [2-oxo-2-(3-oxo-4H-1,4-benzoxazin-6-yl)ethyl] 2-chlorobenzoate.
| Compound Name | [2-oxo-2-(3-oxo-4H-1,4-benzoxazin-6-yl)ethyl] 2-chlorobenzoate |
|---|---|
| PubChem CID | 2409679 |
| Molecular Formula | C17H12ClNO5 |
| Molecular Weight | 345.74 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | [2-oxo-2-(3-oxo-4H-1,4-benzoxazin-6-yl)ethyl] 2-chlorobenzoate |
| SMILES | O=C1COc2ccc(C(=O)COC(=O)c3ccccc3Cl)cc2N1 |
| InChI | InChI=1S/C17H12ClNO5/c18-12-4-2-1-3-11(12)17(22)24-8-14(20)10-5-6-15-13(7-10)19-16(21)9-23-15/h1-7H,8-9H2,(H,19,21) |
| InChIKey | DEVZQOCGVWQYMI-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.74 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |