About [2-(benzylcarbamoylamino)-2-oxoethyl] 2-chlorobenzoate
[2-(benzylcarbamoylamino)-2-oxoethyl] 2-chlorobenzoate (PubChem CID 2410384) has the molecular formula C17H15ClN2O4
and a molecular weight of 346.77 g/mol. Its IUPAC name is [2-(benzylcarbamoylamino)-2-oxoethyl] 2-chlorobenzoate.
Molecular Properties
| Compound Name | [2-(benzylcarbamoylamino)-2-oxoethyl] 2-chlorobenzoate |
| PubChem CID | 2410384 |
| Molecular Formula | C17H15ClN2O4 |
| Molecular Weight | 346.77 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | [2-(benzylcarbamoylamino)-2-oxoethyl] 2-chlorobenzoate |
| SMILES | O=C(COC(=O)c1ccccc1Cl)NC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C17H15ClN2O4/c18-14-9-5-4-8-13(14)16(22)24-11-15(21)20-17(23)19-10-12-6-2-1-3-7-12/h1-9H,10-11H2,(H2,19,20,21,23) |
| InChIKey | BVFJEZTZAHDICP-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.77 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(benzylcarbamoylamino)-2-oxoethyl] 2-chlorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(benzylcarbamoylamino)-2-oxoethyl] 2-chlorobenzoate?
The IUPAC name of [2-(benzylcarbamoylamino)-2-oxoethyl] 2-chlorobenzoate (CID 2410384) is [2-(benzylcarbamoylamino)-2-oxoethyl] 2-chlorobenzoate.
What is the SMILES notation for [2-(benzylcarbamoylamino)-2-oxoethyl] 2-chlorobenzoate?
The canonical SMILES for [2-(benzylcarbamoylamino)-2-oxoethyl] 2-chlorobenzoate is O=C(COC(=O)c1ccccc1Cl)NC(=O)NCc1ccccc1.
What is the InChIKey of [2-(benzylcarbamoylamino)-2-oxoethyl] 2-chlorobenzoate?
The InChIKey is BVFJEZTZAHDICP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15ClN2O4/c18-14-9-5-4-8-13(14)16(22)24-11-15(21)20-17(23)19-10-12-6-2-1-3-7-12/h1-9H,10-11H2,(H2,19,20,21,23).
What are the key properties of [2-(benzylcarbamoylamino)-2-oxoethyl] 2-chlorobenzoate?
[2-(benzylcarbamoylamino)-2-oxoethyl] 2-chlorobenzoate has a molecular weight of 346.77 g/mol, XLogP of 2.52, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(benzylcarbamoylamino)-2-oxoethyl] 2-chlorobenzoate is sourced from PubChem (CID 2410384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).