C19H23N3OS2 — CID 2410811
4-tert-butyl-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylcarbamothioyl)benzamide (PubChem CID 2410811) has the molecular formula C19H23N3OS2 and a molecular weight of 373.55 g/mol. Its IUPAC name is 4-tert-butyl-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylcarbamothioyl)benzamide.
| Compound Name | 4-tert-butyl-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylcarbamothioyl)benzamide |
|---|---|
| PubChem CID | 2410811 |
| Molecular Formula | C19H23N3OS2 |
| Molecular Weight | 373.55 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | 4-tert-butyl-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylcarbamothioyl)benzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)NC(=S)Nc2nc3c(s2)CCCC3)cc1 |
| InChI | InChI=1S/C19H23N3OS2/c1-19(2,3)13-10-8-12(9-11-13)16(23)21-17(24)22-18-20-14-6-4-5-7-15(14)25-18/h8-11H,4-7H2,1-3H3,(H2,20,21,22,23,24) |
| InChIKey | NRCOVFCHCPUKBE-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.55 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|