About 2-(1-oxidopyridin-1-ium-2-yl)sulfanyl-N',N'-diphenylacetohydrazide
2-(1-oxidopyridin-1-ium-2-yl)sulfanyl-N',N'-diphenylacetohydrazide (PubChem CID 2410937) has the molecular formula C19H17N3O2S
and a molecular weight of 351.43 g/mol. Its IUPAC name is 2-(1-oxidopyridin-1-ium-2-yl)sulfanyl-N',N'-diphenylacetohydrazide.
Molecular Properties
| Compound Name | 2-(1-oxidopyridin-1-ium-2-yl)sulfanyl-N',N'-diphenylacetohydrazide |
| PubChem CID | 2410937 |
| Molecular Formula | C19H17N3O2S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | 2-(1-oxidopyridin-1-ium-2-yl)sulfanyl-N',N'-diphenylacetohydrazide |
| SMILES | O=C(CSc1cccc[n+]1[O-])NN(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H17N3O2S/c23-18(15-25-19-13-7-8-14-21(19)24)20-22(16-9-3-1-4-10-16)17-11-5-2-6-12-17/h1-14H,15H2,(H,20,23) |
| InChIKey | JAEHNJDPLVVXMT-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-oxidopyridin-1-ium-2-yl)sulfanyl-N',N'-diphenylacetohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-oxidopyridin-1-ium-2-yl)sulfanyl-N',N'-diphenylacetohydrazide?
The IUPAC name of 2-(1-oxidopyridin-1-ium-2-yl)sulfanyl-N',N'-diphenylacetohydrazide (CID 2410937) is 2-(1-oxidopyridin-1-ium-2-yl)sulfanyl-N',N'-diphenylacetohydrazide.
What is the SMILES notation for 2-(1-oxidopyridin-1-ium-2-yl)sulfanyl-N',N'-diphenylacetohydrazide?
The canonical SMILES for 2-(1-oxidopyridin-1-ium-2-yl)sulfanyl-N',N'-diphenylacetohydrazide is O=C(CSc1cccc[n+]1[O-])NN(c1ccccc1)c1ccccc1.
What is the InChIKey of 2-(1-oxidopyridin-1-ium-2-yl)sulfanyl-N',N'-diphenylacetohydrazide?
The InChIKey is JAEHNJDPLVVXMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17N3O2S/c23-18(15-25-19-13-7-8-14-21(19)24)20-22(16-9-3-1-4-10-16)17-11-5-2-6-12-17/h1-14H,15H2,(H,20,23).
What are the key properties of 2-(1-oxidopyridin-1-ium-2-yl)sulfanyl-N',N'-diphenylacetohydrazide?
2-(1-oxidopyridin-1-ium-2-yl)sulfanyl-N',N'-diphenylacetohydrazide has a molecular weight of 351.43 g/mol, XLogP of 3.28, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-oxidopyridin-1-ium-2-yl)sulfanyl-N',N'-diphenylacetohydrazide is sourced from PubChem (CID 2410937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).