C13H15Cl3N2O2 — CID 2410992
3,5,6-trichloro-4-[(2R)-2-ethylpiperidin-1-yl]pyridine-2-carboxylic acid (PubChem CID 2410992) has the molecular formula C13H15Cl3N2O2 and a molecular weight of 337.63 g/mol. Its IUPAC name is 3,5,6-trichloro-4-[(2R)-2-ethylpiperidin-1-yl]pyridine-2-carboxylic acid.
| Compound Name | 3,5,6-trichloro-4-[(2R)-2-ethylpiperidin-1-yl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 2410992 |
| Molecular Formula | C13H15Cl3N2O2 |
| Molecular Weight | 337.63 g/mol |
| Exact Mass | 336.02 |
| IUPAC Name | 3,5,6-trichloro-4-[(2R)-2-ethylpiperidin-1-yl]pyridine-2-carboxylic acid |
| SMILES | CC[C@@H]1CCCCN1c1c(Cl)c(Cl)nc(C(=O)O)c1Cl |
| InChI | InChI=1S/C13H15Cl3N2O2/c1-2-7-5-3-4-6-18(7)11-8(14)10(13(19)20)17-12(16)9(11)15/h7H,2-6H2,1H3,(H,19,20)/t7-/m1/s1 |
| InChIKey | VUWAGAUEADPEIZ-SSDOTTSWSA-N |
| XLogP | 4.51 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.63 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|