C14H12Cl2N2O5S — CID 2411796
[2-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethylamino]-2-oxoethyl] 2,3-dichlorobenzoate (PubChem CID 2411796) has the molecular formula C14H12Cl2N2O5S and a molecular weight of 391.23 g/mol. Its IUPAC name is [2-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethylamino]-2-oxoethyl] 2,3-dichlorobenzoate.
| Compound Name | [2-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethylamino]-2-oxoethyl] 2,3-dichlorobenzoate |
|---|---|
| PubChem CID | 2411796 |
| Molecular Formula | C14H12Cl2N2O5S |
| Molecular Weight | 391.23 g/mol |
| Exact Mass | 389.98 |
| IUPAC Name | [2-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethylamino]-2-oxoethyl] 2,3-dichlorobenzoate |
| SMILES | O=C(COC(=O)c1cccc(Cl)c1Cl)NCCN1C(=O)CSC1=O |
| InChI | InChI=1S/C14H12Cl2N2O5S/c15-9-3-1-2-8(12(9)16)13(21)23-6-10(19)17-4-5-18-11(20)7-24-14(18)22/h1-3H,4-7H2,(H,17,19) |
| InChIKey | AZDLZPAWSVRYKD-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.23 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|