About 2-ethoxy-2,2-diphenylacetic acid
2-ethoxy-2,2-diphenylacetic acid (PubChem CID 24119) has the molecular formula C16H16O3
and a molecular weight of 256.30 g/mol. Its IUPAC name is 2-ethoxy-2,2-diphenylacetic acid.
Molecular Properties
| Compound Name | 2-ethoxy-2,2-diphenylacetic acid |
| PubChem CID | 24119 |
| Molecular Formula | C16H16O3 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 2-ethoxy-2,2-diphenylacetic acid |
| SMILES | CCOC(C(=O)O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H16O3/c1-2-19-16(15(17)18,13-9-5-3-6-10-13)14-11-7-4-8-12-14/h3-12H,2H2,1H3,(H,17,18) |
| InChIKey | SEUTWLXKEMEBTR-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethoxy-2,2-diphenylacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxy-2,2-diphenylacetic acid?
The IUPAC name of 2-ethoxy-2,2-diphenylacetic acid (CID 24119) is 2-ethoxy-2,2-diphenylacetic acid.
What is the SMILES notation for 2-ethoxy-2,2-diphenylacetic acid?
The canonical SMILES for 2-ethoxy-2,2-diphenylacetic acid is CCOC(C(=O)O)(c1ccccc1)c1ccccc1.
What is the InChIKey of 2-ethoxy-2,2-diphenylacetic acid?
The InChIKey is SEUTWLXKEMEBTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16O3/c1-2-19-16(15(17)18,13-9-5-3-6-10-13)14-11-7-4-8-12-14/h3-12H,2H2,1H3,(H,17,18).
What are the key properties of 2-ethoxy-2,2-diphenylacetic acid?
2-ethoxy-2,2-diphenylacetic acid has a molecular weight of 256.30 g/mol, XLogP of 3.05, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxy-2,2-diphenylacetic acid is sourced from PubChem (CID 24119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).