About 6-nitrochrysene
6-nitrochrysene (PubChem CID 24121) has the molecular formula C18H11NO2
and a molecular weight of 273.29 g/mol. Its IUPAC name is 6-nitrochrysene.
Molecular Properties
| Compound Name | 6-nitrochrysene |
| PubChem CID | 24121 |
| Molecular Formula | C18H11NO2 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 6-nitrochrysene |
| SMILES | O=[N+]([O-])c1cc2c3ccccc3ccc2c2ccccc12 |
| InChI | InChI=1S/C18H11NO2/c20-19(21)18-11-17-13-6-2-1-5-12(13)9-10-15(17)14-7-3-4-8-16(14)18/h1-11H |
| InChIKey | UAWLTQJFZUYROA-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 6-nitrochrysene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-nitrochrysene?
The IUPAC name of 6-nitrochrysene (CID 24121) is 6-nitrochrysene.
What is the SMILES notation for 6-nitrochrysene?
The canonical SMILES for 6-nitrochrysene is O=[N+]([O-])c1cc2c3ccccc3ccc2c2ccccc12.
What is the InChIKey of 6-nitrochrysene?
The InChIKey is UAWLTQJFZUYROA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H11NO2/c20-19(21)18-11-17-13-6-2-1-5-12(13)9-10-15(17)14-7-3-4-8-16(14)18/h1-11H.
What are the key properties of 6-nitrochrysene?
6-nitrochrysene has a molecular weight of 273.29 g/mol, XLogP of 5.05, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-nitrochrysene is sourced from PubChem (CID 24121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).