C19H25ClN2O3 — CID 2412519
[2-oxo-2-[(1S,5R)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]ethyl] 2-amino-4-chlorobenzoate (PubChem CID 2412519) has the molecular formula C19H25ClN2O3 and a molecular weight of 364.87 g/mol. Its IUPAC name is [2-oxo-2-[(1S,5R)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]ethyl] 2-amino-4-chlorobenzoate.
| Compound Name | [2-oxo-2-[(1S,5R)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]ethyl] 2-amino-4-chlorobenzoate |
|---|---|
| PubChem CID | 2412519 |
| Molecular Formula | C19H25ClN2O3 |
| Molecular Weight | 364.87 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | [2-oxo-2-[(1S,5R)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]ethyl] 2-amino-4-chlorobenzoate |
| SMILES | CC1(C)C[C@@H]2C[C@@](C)(CN2C(=O)COC(=O)c2ccc(Cl)cc2N)C1 |
| InChI | InChI=1S/C19H25ClN2O3/c1-18(2)7-13-8-19(3,10-18)11-22(13)16(23)9-25-17(24)14-5-4-12(20)6-15(14)21/h4-6,13H,7-11,21H2,1-3H3/t13-,19-/m1/s1 |
| InChIKey | XGWYJHQRZQXMAE-BFUOFWGJSA-N |
| XLogP | 3.51 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.87 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|