About tert-butyl 2-[[5-(3-benzyl-4-oxophthalazin-1-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetate
tert-butyl 2-[[5-(3-benzyl-4-oxophthalazin-1-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetate (PubChem CID 2412730) has the molecular formula C23H22N4O4S
and a molecular weight of 450.52 g/mol. Its IUPAC name is tert-butyl 2-[[5-(3-benzyl-4-oxophthalazin-1-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetate.
Molecular Properties
| Compound Name | tert-butyl 2-[[5-(3-benzyl-4-oxophthalazin-1-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetate |
| PubChem CID | 2412730 |
| Molecular Formula | C23H22N4O4S |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | tert-butyl 2-[[5-(3-benzyl-4-oxophthalazin-1-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetate |
| SMILES | CC(C)(C)OC(=O)CSc1nnc(-c2nn(Cc3ccccc3)c(=O)c3ccccc23)o1 |
| InChI | InChI=1S/C23H22N4O4S/c1-23(2,3)31-18(28)14-32-22-25-24-20(30-22)19-16-11-7-8-12-17(16)21(29)27(26-19)13-15-9-5-4-6-10-15/h4-12H,13-14H2,1-3H3 |
| InChIKey | VKIPVQNFINALLH-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 100.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze tert-butyl 2-[[5-(3-benzyl-4-oxophthalazin-1-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-[[5-(3-benzyl-4-oxophthalazin-1-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetate?
The IUPAC name of tert-butyl 2-[[5-(3-benzyl-4-oxophthalazin-1-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetate (CID 2412730) is tert-butyl 2-[[5-(3-benzyl-4-oxophthalazin-1-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetate.
What is the SMILES notation for tert-butyl 2-[[5-(3-benzyl-4-oxophthalazin-1-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetate?
The canonical SMILES for tert-butyl 2-[[5-(3-benzyl-4-oxophthalazin-1-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetate is CC(C)(C)OC(=O)CSc1nnc(-c2nn(Cc3ccccc3)c(=O)c3ccccc23)o1.
What is the InChIKey of tert-butyl 2-[[5-(3-benzyl-4-oxophthalazin-1-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetate?
The InChIKey is VKIPVQNFINALLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22N4O4S/c1-23(2,3)31-18(28)14-32-22-25-24-20(30-22)19-16-11-7-8-12-17(16)21(29)27(26-19)13-15-9-5-4-6-10-15/h4-12H,13-14H2,1-3H3.
What are the key properties of tert-butyl 2-[[5-(3-benzyl-4-oxophthalazin-1-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetate?
tert-butyl 2-[[5-(3-benzyl-4-oxophthalazin-1-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetate has a molecular weight of 450.52 g/mol, XLogP of 3.93, 6 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-[[5-(3-benzyl-4-oxophthalazin-1-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetate is sourced from PubChem (CID 2412730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).