About [2-oxo-2-[(4-phenyl-1,3-thiazol-2-yl)amino]ethyl] 2-acetamidoacetate
[2-oxo-2-[(4-phenyl-1,3-thiazol-2-yl)amino]ethyl] 2-acetamidoacetate (PubChem CID 2412869) has the molecular formula C15H15N3O4S
and a molecular weight of 333.37 g/mol. Its IUPAC name is [2-oxo-2-[(4-phenyl-1,3-thiazol-2-yl)amino]ethyl] 2-acetamidoacetate.
Molecular Properties
| Compound Name | [2-oxo-2-[(4-phenyl-1,3-thiazol-2-yl)amino]ethyl] 2-acetamidoacetate |
| PubChem CID | 2412869 |
| Molecular Formula | C15H15N3O4S |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | [2-oxo-2-[(4-phenyl-1,3-thiazol-2-yl)amino]ethyl] 2-acetamidoacetate |
| SMILES | CC(=O)NCC(=O)OCC(=O)Nc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C15H15N3O4S/c1-10(19)16-7-14(21)22-8-13(20)18-15-17-12(9-23-15)11-5-3-2-4-6-11/h2-6,9H,7-8H2,1H3,(H,16,19)(H,17,18,20) |
| InChIKey | ZDSHJOVCTYCHHH-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-oxo-2-[(4-phenyl-1,3-thiazol-2-yl)amino]ethyl] 2-acetamidoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-oxo-2-[(4-phenyl-1,3-thiazol-2-yl)amino]ethyl] 2-acetamidoacetate?
The IUPAC name of [2-oxo-2-[(4-phenyl-1,3-thiazol-2-yl)amino]ethyl] 2-acetamidoacetate (CID 2412869) is [2-oxo-2-[(4-phenyl-1,3-thiazol-2-yl)amino]ethyl] 2-acetamidoacetate.
What is the SMILES notation for [2-oxo-2-[(4-phenyl-1,3-thiazol-2-yl)amino]ethyl] 2-acetamidoacetate?
The canonical SMILES for [2-oxo-2-[(4-phenyl-1,3-thiazol-2-yl)amino]ethyl] 2-acetamidoacetate is CC(=O)NCC(=O)OCC(=O)Nc1nc(-c2ccccc2)cs1.
What is the InChIKey of [2-oxo-2-[(4-phenyl-1,3-thiazol-2-yl)amino]ethyl] 2-acetamidoacetate?
The InChIKey is ZDSHJOVCTYCHHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N3O4S/c1-10(19)16-7-14(21)22-8-13(20)18-15-17-12(9-23-15)11-5-3-2-4-6-11/h2-6,9H,7-8H2,1H3,(H,16,19)(H,17,18,20).
What are the key properties of [2-oxo-2-[(4-phenyl-1,3-thiazol-2-yl)amino]ethyl] 2-acetamidoacetate?
[2-oxo-2-[(4-phenyl-1,3-thiazol-2-yl)amino]ethyl] 2-acetamidoacetate has a molecular weight of 333.37 g/mol, XLogP of 1.43, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-oxo-2-[(4-phenyl-1,3-thiazol-2-yl)amino]ethyl] 2-acetamidoacetate is sourced from PubChem (CID 2412869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).