About [2-oxo-2-(1,3-thiazol-2-ylamino)ethyl] 2-oxo-1H-quinoline-4-carboxylate
[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl] 2-oxo-1H-quinoline-4-carboxylate (PubChem CID 2413013) has the molecular formula C15H11N3O4S
and a molecular weight of 329.34 g/mol. Its IUPAC name is [2-oxo-2-(1,3-thiazol-2-ylamino)ethyl] 2-oxo-1H-quinoline-4-carboxylate.
Molecular Properties
| Compound Name | [2-oxo-2-(1,3-thiazol-2-ylamino)ethyl] 2-oxo-1H-quinoline-4-carboxylate |
| PubChem CID | 2413013 |
| Molecular Formula | C15H11N3O4S |
| Molecular Weight | 329.34 g/mol |
| Exact Mass | 329.05 |
| IUPAC Name | [2-oxo-2-(1,3-thiazol-2-ylamino)ethyl] 2-oxo-1H-quinoline-4-carboxylate |
| SMILES | O=C(COC(=O)c1cc(=O)[nH]c2ccccc12)Nc1nccs1 |
| InChI | InChI=1S/C15H11N3O4S/c19-12-7-10(9-3-1-2-4-11(9)17-12)14(21)22-8-13(20)18-15-16-5-6-23-15/h1-7H,8H2,(H,17,19)(H,16,18,20) |
| InChIKey | FJDKTKGYNBORNQ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.34 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-oxo-2-(1,3-thiazol-2-ylamino)ethyl] 2-oxo-1H-quinoline-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-oxo-2-(1,3-thiazol-2-ylamino)ethyl] 2-oxo-1H-quinoline-4-carboxylate?
The IUPAC name of [2-oxo-2-(1,3-thiazol-2-ylamino)ethyl] 2-oxo-1H-quinoline-4-carboxylate (CID 2413013) is [2-oxo-2-(1,3-thiazol-2-ylamino)ethyl] 2-oxo-1H-quinoline-4-carboxylate.
What is the SMILES notation for [2-oxo-2-(1,3-thiazol-2-ylamino)ethyl] 2-oxo-1H-quinoline-4-carboxylate?
The canonical SMILES for [2-oxo-2-(1,3-thiazol-2-ylamino)ethyl] 2-oxo-1H-quinoline-4-carboxylate is O=C(COC(=O)c1cc(=O)[nH]c2ccccc12)Nc1nccs1.
What is the InChIKey of [2-oxo-2-(1,3-thiazol-2-ylamino)ethyl] 2-oxo-1H-quinoline-4-carboxylate?
The InChIKey is FJDKTKGYNBORNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11N3O4S/c19-12-7-10(9-3-1-2-4-11(9)17-12)14(21)22-8-13(20)18-15-16-5-6-23-15/h1-7H,8H2,(H,17,19)(H,16,18,20).
What are the key properties of [2-oxo-2-(1,3-thiazol-2-ylamino)ethyl] 2-oxo-1H-quinoline-4-carboxylate?
[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl] 2-oxo-1H-quinoline-4-carboxylate has a molecular weight of 329.34 g/mol, XLogP of 1.78, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-oxo-2-(1,3-thiazol-2-ylamino)ethyl] 2-oxo-1H-quinoline-4-carboxylate is sourced from PubChem (CID 2413013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).