C26H23NO5 — CID 2413548
ethyl 4-[2-(anthracene-9-carbonyloxy)acetyl]-2,5-dimethyl-1H-pyrrole-3-carboxylate (PubChem CID 2413548) has the molecular formula C26H23NO5 and a molecular weight of 429.47 g/mol. Its IUPAC name is ethyl 4-[2-(anthracene-9-carbonyloxy)acetyl]-2,5-dimethyl-1H-pyrrole-3-carboxylate.
| Compound Name | ethyl 4-[2-(anthracene-9-carbonyloxy)acetyl]-2,5-dimethyl-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 2413548 |
| Molecular Formula | C26H23NO5 |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | ethyl 4-[2-(anthracene-9-carbonyloxy)acetyl]-2,5-dimethyl-1H-pyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)[nH]c(C)c1C(=O)COC(=O)c1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C26H23NO5/c1-4-31-25(29)23-16(3)27-15(2)22(23)21(28)14-32-26(30)24-19-11-7-5-9-17(19)13-18-10-6-8-12-20(18)24/h5-13,27H,4,14H2,1-3H3 |
| InChIKey | MGILQDQGEJDLJA-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 85.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|