C23H23NO6 — CID 2413732
[2-[2,5-dimethyl-1-[[(2S)-oxolan-2-yl]methyl]pyrrol-3-yl]-2-oxoethyl] 2-oxochromene-3-carboxylate (PubChem CID 2413732) has the molecular formula C23H23NO6 and a molecular weight of 409.44 g/mol. Its IUPAC name is [2-[2,5-dimethyl-1-[[(2S)-oxolan-2-yl]methyl]pyrrol-3-yl]-2-oxoethyl] 2-oxochromene-3-carboxylate.
| Compound Name | [2-[2,5-dimethyl-1-[[(2S)-oxolan-2-yl]methyl]pyrrol-3-yl]-2-oxoethyl] 2-oxochromene-3-carboxylate |
|---|---|
| PubChem CID | 2413732 |
| Molecular Formula | C23H23NO6 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | [2-[2,5-dimethyl-1-[[(2S)-oxolan-2-yl]methyl]pyrrol-3-yl]-2-oxoethyl] 2-oxochromene-3-carboxylate |
| SMILES | Cc1cc(C(=O)COC(=O)c2cc3ccccc3oc2=O)c(C)n1C[C@@H]1CCCO1 |
| InChI | InChI=1S/C23H23NO6/c1-14-10-18(15(2)24(14)12-17-7-5-9-28-17)20(25)13-29-22(26)19-11-16-6-3-4-8-21(16)30-23(19)27/h3-4,6,8,10-11,17H,5,7,9,12-13H2,1-2H3/t17-/m0/s1 |
| InChIKey | PHQKYKBUZFQBNV-KRWDZBQOSA-N |
| XLogP | 3.43 |
| TPSA | 87.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|