C22H18ClN3S2 — CID 2414374
3-amino-4-(1,3-benzothiazol-2-yl)-2-(4-chlorophenyl)-5,6,7,8-tetrahydroisoquinoline-1-thione (PubChem CID 2414374) has the molecular formula C22H18ClN3S2 and a molecular weight of 423.99 g/mol. Its IUPAC name is 3-amino-4-(1,3-benzothiazol-2-yl)-2-(4-chlorophenyl)-5,6,7,8-tetrahydroisoquinoline-1-thione.
| Compound Name | 3-amino-4-(1,3-benzothiazol-2-yl)-2-(4-chlorophenyl)-5,6,7,8-tetrahydroisoquinoline-1-thione |
|---|---|
| PubChem CID | 2414374 |
| Molecular Formula | C22H18ClN3S2 |
| Molecular Weight | 423.99 g/mol |
| Exact Mass | 423.06 |
| IUPAC Name | 3-amino-4-(1,3-benzothiazol-2-yl)-2-(4-chlorophenyl)-5,6,7,8-tetrahydroisoquinoline-1-thione |
| SMILES | Nc1c(-c2nc3ccccc3s2)c2c(c(=S)n1-c1ccc(Cl)cc1)CCCC2 |
| InChI | InChI=1S/C22H18ClN3S2/c23-13-9-11-14(12-10-13)26-20(24)19(15-5-1-2-6-16(15)22(26)27)21-25-17-7-3-4-8-18(17)28-21/h3-4,7-12H,1-2,5-6,24H2 |
| InChIKey | RZVVEECBCWVCJY-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.99 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|