C25H28N2O2 — CID 24144
acridin-9-amine;4-hexylbenzene-1,3-diol (PubChem CID 24144) has the molecular formula C25H28N2O2 and a molecular weight of 388.51 g/mol. Its IUPAC name is acridin-9-amine;4-hexylbenzene-1,3-diol.
| Compound Name | acridin-9-amine;4-hexylbenzene-1,3-diol |
|---|---|
| PubChem CID | 24144 |
| Molecular Formula | C25H28N2O2 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | acridin-9-amine;4-hexylbenzene-1,3-diol |
| SMILES | CCCCCCc1ccc(O)cc1O.Nc1c2ccccc2nc2ccccc12 |
| InChI | InChI=1S/C13H10N2.C12H18O2/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13;1-2-3-4-5-6-10-7-8-11(13)9-12(10)14/h1-8H,(H2,14,15);7-9,13-14H,2-6H2,1H3 |
| InChIKey | YZODJQFXMFEJRM-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|