C19H19FN2O2 — CID 2415467
N'-(1-cyclopropylideneethyl)-2-[(4-fluorophenyl)methoxy]benzohydrazide (PubChem CID 2415467) has the molecular formula C19H19FN2O2 and a molecular weight of 326.37 g/mol. Its IUPAC name is N'-(1-cyclopropylideneethyl)-2-[(4-fluorophenyl)methoxy]benzohydrazide.
| Compound Name | N'-(1-cyclopropylideneethyl)-2-[(4-fluorophenyl)methoxy]benzohydrazide |
|---|---|
| PubChem CID | 2415467 |
| Molecular Formula | C19H19FN2O2 |
| Molecular Weight | 326.37 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | N'-(1-cyclopropylideneethyl)-2-[(4-fluorophenyl)methoxy]benzohydrazide |
| SMILES | CC(NNC(=O)c1ccccc1OCc1ccc(F)cc1)=C1CC1 |
| InChI | InChI=1S/C19H19FN2O2/c1-13(15-8-9-15)21-22-19(23)17-4-2-3-5-18(17)24-12-14-6-10-16(20)11-7-14/h2-7,10-11,21H,8-9,12H2,1H3,(H,22,23) |
| InChIKey | PDTIGXFPJHYEIK-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.37 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|