C26H20N2O2S — CID 2415818
5-(4-methylphenyl)-4-(4-phenylmethoxyphenoxy)thieno[2,3-d]pyrimidine (PubChem CID 2415818) has the molecular formula C26H20N2O2S and a molecular weight of 424.53 g/mol. Its IUPAC name is 5-(4-methylphenyl)-4-(4-phenylmethoxyphenoxy)thieno[2,3-d]pyrimidine.
| Compound Name | 5-(4-methylphenyl)-4-(4-phenylmethoxyphenoxy)thieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 2415818 |
| Molecular Formula | C26H20N2O2S |
| Molecular Weight | 424.53 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | 5-(4-methylphenyl)-4-(4-phenylmethoxyphenoxy)thieno[2,3-d]pyrimidine |
| SMILES | Cc1ccc(-c2csc3ncnc(Oc4ccc(OCc5ccccc5)cc4)c23)cc1 |
| InChI | InChI=1S/C26H20N2O2S/c1-18-7-9-20(10-8-18)23-16-31-26-24(23)25(27-17-28-26)30-22-13-11-21(12-14-22)29-15-19-5-3-2-4-6-19/h2-14,16-17H,15H2,1H3 |
| InChIKey | WHWAWKNKUSIFSX-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.53 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |