C22H29NO6 — CID 2415983
[2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl] (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate (PubChem CID 2415983) has the molecular formula C22H29NO6 and a molecular weight of 403.48 g/mol. Its IUPAC name is [2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl] (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate.
| Compound Name | [2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl] (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 2415983 |
| Molecular Formula | C22H29NO6 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | [2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl] (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)OCC(=O)NCCC2=CCCCC2)cc(OC)c1OC |
| InChI | InChI=1S/C22H29NO6/c1-26-18-13-17(14-19(27-2)22(18)28-3)9-10-21(25)29-15-20(24)23-12-11-16-7-5-4-6-8-16/h7,9-10,13-14H,4-6,8,11-12,15H2,1-3H3,(H,23,24)/b10-9+ |
| InChIKey | QBSJGEFCHURMER-MDZDMXLPSA-N |
| XLogP | 3.28 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|