C17H31NO2 — CID 24160
2-(8-tert-butyl-1,4-dioxaspiro[4.5]decan-3-yl)piperidine (PubChem CID 24160) has the molecular formula C17H31NO2 and a molecular weight of 281.44 g/mol. Its IUPAC name is 2-(8-tert-butyl-1,4-dioxaspiro[4.5]decan-3-yl)piperidine.
| Compound Name | 2-(8-tert-butyl-1,4-dioxaspiro[4.5]decan-3-yl)piperidine |
|---|---|
| PubChem CID | 24160 |
| Molecular Formula | C17H31NO2 |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.24 |
| IUPAC Name | 2-(8-tert-butyl-1,4-dioxaspiro[4.5]decan-3-yl)piperidine |
| SMILES | CC(C)(C)C1CCC2(CC1)OCC(C1CCCCN1)O2 |
| InChI | InChI=1S/C17H31NO2/c1-16(2,3)13-7-9-17(10-8-13)19-12-15(20-17)14-6-4-5-11-18-14/h13-15,18H,4-12H2,1-3H3 |
| InChIKey | KZUOLAKBJHYWFA-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |