C16H14N2O4 — CID 2416067
[2-(2,3-dihydroindol-1-yl)-2-oxoethyl] 1-oxidopyridin-1-ium-3-carboxylate (PubChem CID 2416067) has the molecular formula C16H14N2O4 and a molecular weight of 298.30 g/mol. Its IUPAC name is [2-(2,3-dihydroindol-1-yl)-2-oxoethyl] 1-oxidopyridin-1-ium-3-carboxylate.
| Compound Name | [2-(2,3-dihydroindol-1-yl)-2-oxoethyl] 1-oxidopyridin-1-ium-3-carboxylate |
|---|---|
| PubChem CID | 2416067 |
| Molecular Formula | C16H14N2O4 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | [2-(2,3-dihydroindol-1-yl)-2-oxoethyl] 1-oxidopyridin-1-ium-3-carboxylate |
| SMILES | O=C(OCC(=O)N1CCc2ccccc21)c1ccc[n+]([O-])c1 |
| InChI | InChI=1S/C16H14N2O4/c19-15(18-9-7-12-4-1-2-6-14(12)18)11-22-16(20)13-5-3-8-17(21)10-13/h1-6,8,10H,7,9,11H2 |
| InChIKey | VONMHYJRYTUJOP-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 73.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|