C19H17F2N3O2S — CID 2416516
(4R,5S)-4-[2-(difluoromethoxy)phenyl]-6-methylidene-N-phenyl-2-sulfanylidene-1,3-diazinane-5-carboxamide (PubChem CID 2416516) has the molecular formula C19H17F2N3O2S and a molecular weight of 389.43 g/mol. Its IUPAC name is (4R,5S)-4-[2-(difluoromethoxy)phenyl]-6-methylidene-N-phenyl-2-sulfanylidene-1,3-diazinane-5-carboxamide.
| Compound Name | (4R,5S)-4-[2-(difluoromethoxy)phenyl]-6-methylidene-N-phenyl-2-sulfanylidene-1,3-diazinane-5-carboxamide |
|---|---|
| PubChem CID | 2416516 |
| Molecular Formula | C19H17F2N3O2S |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | (4R,5S)-4-[2-(difluoromethoxy)phenyl]-6-methylidene-N-phenyl-2-sulfanylidene-1,3-diazinane-5-carboxamide |
| SMILES | C=C1NC(=S)N[C@@H](c2ccccc2OC(F)F)[C@@H]1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C19H17F2N3O2S/c1-11-15(17(25)23-12-7-3-2-4-8-12)16(24-19(27)22-11)13-9-5-6-10-14(13)26-18(20)21/h2-10,15-16,18H,1H2,(H,23,25)(H2,22,24,27)/t15-,16+/m1/s1 |
| InChIKey | QTWMNOLTURPIIU-CVEARBPZSA-N |
| XLogP | 3.58 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|