About [2-(4-carbamoylanilino)-2-oxoethyl] 3-cyclohexylpropanoate
[2-(4-carbamoylanilino)-2-oxoethyl] 3-cyclohexylpropanoate (PubChem CID 2416940) has the molecular formula C18H24N2O4
and a molecular weight of 332.40 g/mol. Its IUPAC name is [2-(4-carbamoylanilino)-2-oxoethyl] 3-cyclohexylpropanoate.
Molecular Properties
| Compound Name | [2-(4-carbamoylanilino)-2-oxoethyl] 3-cyclohexylpropanoate |
| PubChem CID | 2416940 |
| Molecular Formula | C18H24N2O4 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | [2-(4-carbamoylanilino)-2-oxoethyl] 3-cyclohexylpropanoate |
| SMILES | NC(=O)c1ccc(NC(=O)COC(=O)CCC2CCCCC2)cc1 |
| InChI | InChI=1S/C18H24N2O4/c19-18(23)14-7-9-15(10-8-14)20-16(21)12-24-17(22)11-6-13-4-2-1-3-5-13/h7-10,13H,1-6,11-12H2,(H2,19,23)(H,20,21) |
| InChIKey | FMPNFUHUVNCZQK-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(4-carbamoylanilino)-2-oxoethyl] 3-cyclohexylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4-carbamoylanilino)-2-oxoethyl] 3-cyclohexylpropanoate?
The IUPAC name of [2-(4-carbamoylanilino)-2-oxoethyl] 3-cyclohexylpropanoate (CID 2416940) is [2-(4-carbamoylanilino)-2-oxoethyl] 3-cyclohexylpropanoate.
What is the SMILES notation for [2-(4-carbamoylanilino)-2-oxoethyl] 3-cyclohexylpropanoate?
The canonical SMILES for [2-(4-carbamoylanilino)-2-oxoethyl] 3-cyclohexylpropanoate is NC(=O)c1ccc(NC(=O)COC(=O)CCC2CCCCC2)cc1.
What is the InChIKey of [2-(4-carbamoylanilino)-2-oxoethyl] 3-cyclohexylpropanoate?
The InChIKey is FMPNFUHUVNCZQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24N2O4/c19-18(23)14-7-9-15(10-8-14)20-16(21)12-24-17(22)11-6-13-4-2-1-3-5-13/h7-10,13H,1-6,11-12H2,(H2,19,23)(H,20,21).
What are the key properties of [2-(4-carbamoylanilino)-2-oxoethyl] 3-cyclohexylpropanoate?
[2-(4-carbamoylanilino)-2-oxoethyl] 3-cyclohexylpropanoate has a molecular weight of 332.40 g/mol, XLogP of 2.63, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4-carbamoylanilino)-2-oxoethyl] 3-cyclohexylpropanoate is sourced from PubChem (CID 2416940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).